C14H25F5O2S — CID 173258572
9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonan-4-ol (PubChem CID 173258572) has the molecular formula C14H25F5O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is 9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonan-4-ol.
| Compound Name | 9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonan-4-ol |
|---|---|
| PubChem CID | 173258572 |
| Molecular Formula | C14H25F5O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonan-4-ol |
| SMILES | CCCC(O)CCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H25F5O2S/c1-2-7-12(20)8-4-3-5-10-22(21)11-6-9-13(15,16)14(17,18)19/h12,20H,2-11H2,1H3 |
| InChIKey | OWSCELJTSHRUBP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|