C28H27NO5S — CID 173259407
methyl 2-[[4,4-dimethyl-3-(4-methylsulfonylphenyl)-2-phenylcyclobut-2-en-1-ylidene]amino]oxy-2-phenylacetate (PubChem CID 173259407) has the molecular formula C28H27NO5S and a molecular weight of 489.59 g/mol. Its IUPAC name is methyl 2-[[4,4-dimethyl-3-(4-methylsulfonylphenyl)-2-phenylcyclobut-2-en-1-ylidene]amino]oxy-2-phenylacetate.
| Compound Name | methyl 2-[[4,4-dimethyl-3-(4-methylsulfonylphenyl)-2-phenylcyclobut-2-en-1-ylidene]amino]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 173259407 |
| Molecular Formula | C28H27NO5S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 2-[[4,4-dimethyl-3-(4-methylsulfonylphenyl)-2-phenylcyclobut-2-en-1-ylidene]amino]oxy-2-phenylacetate |
| SMILES | COC(=O)C(ON=C1C(c2ccccc2)=C(c2ccc(S(C)(=O)=O)cc2)C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H27NO5S/c1-28(2)24(20-15-17-22(18-16-20)35(4,31)32)23(19-11-7-5-8-12-19)26(28)29-34-25(27(30)33-3)21-13-9-6-10-14-21/h5-18,25H,1-4H3 |
| InChIKey | GVAFYSLFFLFHOM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|