About 7-aminohepta-4,6-diene-1,5-diol
7-aminohepta-4,6-diene-1,5-diol (PubChem CID 173259562) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 7-aminohepta-4,6-diene-1,5-diol.
Molecular Properties
| Compound Name | 7-aminohepta-4,6-diene-1,5-diol |
| PubChem CID | 173259562 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 7-aminohepta-4,6-diene-1,5-diol |
| SMILES | NC=CC(O)=CCCCO |
| InChI | InChI=1S/C7H13NO2/c8-5-4-7(10)3-1-2-6-9/h3-5,9-10H,1-2,6,8H2 |
| InChIKey | PLBXPJBMKGDJSQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-aminohepta-4,6-diene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminohepta-4,6-diene-1,5-diol?
The IUPAC name of 7-aminohepta-4,6-diene-1,5-diol (CID 173259562) is 7-aminohepta-4,6-diene-1,5-diol.
What is the SMILES notation for 7-aminohepta-4,6-diene-1,5-diol?
The canonical SMILES for 7-aminohepta-4,6-diene-1,5-diol is NC=CC(O)=CCCCO.
What is the InChIKey of 7-aminohepta-4,6-diene-1,5-diol?
The InChIKey is PLBXPJBMKGDJSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c8-5-4-7(10)3-1-2-6-9/h3-5,9-10H,1-2,6,8H2.
What are the key properties of 7-aminohepta-4,6-diene-1,5-diol?
7-aminohepta-4,6-diene-1,5-diol has a molecular weight of 143.19 g/mol, XLogP of 0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminohepta-4,6-diene-1,5-diol is sourced from PubChem (CID 173259562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).