C7H14 — CID 17326
cis-(1S,3R)-1,3-dimethylcyclopentane (PubChem CID 17326) has the molecular formula C7H14 and a molecular weight of 98.19 g/mol. Its IUPAC name is cis-(1S,3R)-1,3-dimethylcyclopentane.
| Compound Name | cis-(1S,3R)-1,3-dimethylcyclopentane |
|---|---|
| PubChem CID | 17326 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.19 g/mol |
| Exact Mass | 98.11 |
| IUPAC Name | cis-(1S,3R)-1,3-dimethylcyclopentane |
| SMILES | C[C@@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C7H14/c1-6-3-4-7(2)5-6/h6-7H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | XAZKFISIRYLAEE-KNVOCYPGSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |