About 5-phenylthiadiazol-3-ium
5-phenylthiadiazol-3-ium (PubChem CID 173263194) has the molecular formula C8H7N2S+
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-phenylthiadiazol-3-ium.
Molecular Properties
| Compound Name | 5-phenylthiadiazol-3-ium |
| PubChem CID | 173263194 |
| Molecular Formula | C8H7N2S+ |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 5-phenylthiadiazol-3-ium |
| SMILES | c1ccc(-c2c[nH+]ns2)cc1 |
| InChI | InChI=1S/C8H6N2S/c1-2-4-7(5-3-1)8-6-9-10-11-8/h1-6H/p+1 |
| InChIKey | MXTVVTVVBOYKCU-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenylthiadiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylthiadiazol-3-ium?
The IUPAC name of 5-phenylthiadiazol-3-ium (CID 173263194) is 5-phenylthiadiazol-3-ium.
What is the SMILES notation for 5-phenylthiadiazol-3-ium?
The canonical SMILES for 5-phenylthiadiazol-3-ium is c1ccc(-c2c[nH+]ns2)cc1.
What is the InChIKey of 5-phenylthiadiazol-3-ium?
The InChIKey is MXTVVTVVBOYKCU-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6N2S/c1-2-4-7(5-3-1)8-6-9-10-11-8/h1-6H/p+1.
What are the key properties of 5-phenylthiadiazol-3-ium?
5-phenylthiadiazol-3-ium has a molecular weight of 163.22 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylthiadiazol-3-ium is sourced from PubChem (CID 173263194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).