C17H13F3N2O — CID 173263365
12-oxido-9-(trifluoromethyl)-1,5,6,7-tetrahydroindolo[3,2-d][1]benzazepin-12-ium (PubChem CID 173263365) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 12-oxido-9-(trifluoromethyl)-1,5,6,7-tetrahydroindolo[3,2-d][1]benzazepin-12-ium.
| Compound Name | 12-oxido-9-(trifluoromethyl)-1,5,6,7-tetrahydroindolo[3,2-d][1]benzazepin-12-ium |
|---|---|
| PubChem CID | 173263365 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 12-oxido-9-(trifluoromethyl)-1,5,6,7-tetrahydroindolo[3,2-d][1]benzazepin-12-ium |
| SMILES | [O-][N+]1=c2ccc(C(F)(F)F)cc2=C2CCNC3=CC=CCC3=C21 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)10-5-6-15-13(9-10)11-7-8-21-14-4-2-1-3-12(14)16(11)22(15)23/h1-2,4-6,9,21H,3,7-8H2 |
| InChIKey | MBGQWDJSNUWPRG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|