About 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium
2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium (PubChem CID 173264054) has the molecular formula C36H37Zr-
and a molecular weight of 560.92 g/mol. Its IUPAC name is 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium.
Molecular Properties
| Compound Name | 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium |
| PubChem CID | 173264054 |
| Molecular Formula | C36H37Zr- |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium |
| SMILES | CC(C)(C)c1ccc2c(c1[CH-]Cc1c(C(C)(C)C)ccc3c1Cc1ccccc1-3)Cc1ccccc1-2.[Zr] |
| InChI | InChI=1S/C36H37.Zr/c1-35(2,3)33-19-17-27-25-13-9-7-11-23(25)21-31(27)29(33)15-16-30-32-22-24-12-8-10-14-26(24)28(32)18-20-34(30)36(4,5)6;/h7-15,17-20H,16,21-22H2,1-6H3;/q-1; |
| InChIKey | BEIQKTXMXTUMCG-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium?
The IUPAC name of 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium (CID 173264054) is 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium.
What is the SMILES notation for 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium?
The canonical SMILES for 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium is CC(C)(C)c1ccc2c(c1[CH-]Cc1c(C(C)(C)C)ccc3c1Cc1ccccc1-3)Cc1ccccc1-2.[Zr].
What is the InChIKey of 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium?
The InChIKey is BEIQKTXMXTUMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H37.Zr/c1-35(2,3)33-19-17-27-25-13-9-7-11-23(25)21-31(27)29(33)15-16-30-32-22-24-12-8-10-14-26(24)28(32)18-20-34(30)36(4,5)6;/h7-15,17-20H,16,21-22H2,1-6H3;/q-1;.
What are the key properties of 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium?
2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium has a molecular weight of 560.92 g/mol, XLogP of 9.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-[2-(2-tert-butyl-9H-fluoren-1-yl)ethyl]-9H-fluorene;zirconium is sourced from PubChem (CID 173264054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).