About 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium
3-fluoro-1-oxido-2,3-dihydropyridin-1-ium (PubChem CID 173264321) has the molecular formula C5H6FNO
and a molecular weight of 115.11 g/mol. Its IUPAC name is 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium |
| PubChem CID | 173264321 |
| Molecular Formula | C5H6FNO |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium |
| SMILES | [O-][N+]1=CC=CC(F)C1 |
| InChI | InChI=1S/C5H6FNO/c6-5-2-1-3-7(8)4-5/h1-3,5H,4H2 |
| InChIKey | YLLCVWZMPNFPRL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium?
The IUPAC name of 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium (CID 173264321) is 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium?
The canonical SMILES for 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium is [O-][N+]1=CC=CC(F)C1.
What is the InChIKey of 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium?
The InChIKey is YLLCVWZMPNFPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FNO/c6-5-2-1-3-7(8)4-5/h1-3,5H,4H2.
What are the key properties of 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium?
3-fluoro-1-oxido-2,3-dihydropyridin-1-ium has a molecular weight of 115.11 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-oxido-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 173264321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).