C30H44N6O4S2 — CID 173264591
bis(3-hex-5-enyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole);oxalic acid (PubChem CID 173264591) has the molecular formula C30H44N6O4S2 and a molecular weight of 616.85 g/mol. Its IUPAC name is bis(3-hex-5-enyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole);oxalic acid.
| Compound Name | bis(3-hex-5-enyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole);oxalic acid |
|---|---|
| PubChem CID | 173264591 |
| Molecular Formula | C30H44N6O4S2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | bis(3-hex-5-enyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole);oxalic acid |
| SMILES | C=CCCCCc1nsnc1C1=CCCN(C)C1.C=CCCCCc1nsnc1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C14H21N3S.C2H2O4/c2*1-3-4-5-6-9-13-14(16-18-15-13)12-8-7-10-17(2)11-12;3-1(4)2(5)6/h2*3,8H,1,4-7,9-11H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | PYVKNDHBOQBIBX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|