C28H44N6O4S2 — CID 173264681
bis(3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-pentyl-1,2,5-thiadiazole);oxalic acid (PubChem CID 173264681) has the molecular formula C28H44N6O4S2 and a molecular weight of 592.83 g/mol. Its IUPAC name is bis(3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-pentyl-1,2,5-thiadiazole);oxalic acid.
| Compound Name | bis(3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-pentyl-1,2,5-thiadiazole);oxalic acid |
|---|---|
| PubChem CID | 173264681 |
| Molecular Formula | C28H44N6O4S2 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | bis(3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-pentyl-1,2,5-thiadiazole);oxalic acid |
| SMILES | CCCCCc1nsnc1C1=CCCN(C)C1.CCCCCc1nsnc1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C13H21N3S.C2H2O4/c2*1-3-4-5-8-12-13(15-17-14-12)11-7-6-9-16(2)10-11;3-1(4)2(5)6/h2*7H,3-6,8-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DFTTXUJUJRUBBT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|