C18H27N4O5P — CID 173265133
[4-[[(2S)-2-aminopropanoyl]amino]phenoxy]-[(2R)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidin-2-yl]phosphinic acid (PubChem CID 173265133) has the molecular formula C18H27N4O5P and a molecular weight of 410.41 g/mol. Its IUPAC name is [4-[[(2S)-2-aminopropanoyl]amino]phenoxy]-[(2R)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidin-2-yl]phosphinic acid.
| Compound Name | [4-[[(2S)-2-aminopropanoyl]amino]phenoxy]-[(2R)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidin-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 173265133 |
| Molecular Formula | C18H27N4O5P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [4-[[(2S)-2-aminopropanoyl]amino]phenoxy]-[(2R)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidin-2-yl]phosphinic acid |
| SMILES | C[C@H](N)C(=O)Nc1ccc(OP(=O)(O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C18H27N4O5P/c1-12(19)17(23)21-13-6-8-14(9-7-13)27-28(25,26)16-5-3-11-22(16)18(24)15-4-2-10-20-15/h6-9,12,15-16,20H,2-5,10-11,19H2,1H3,(H,21,23)(H,25,26)/t12-,15-,16+/m0/s1 |
| InChIKey | JVLCEAIXGNMKMM-VBNZEHGJSA-N |
| XLogP | 1.24 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|