About tris(2,5-dimethylphenyl)alumane
tris(2,5-dimethylphenyl)alumane (PubChem CID 173265347) has the molecular formula C24H27Al
and a molecular weight of 342.46 g/mol. Its IUPAC name is tris(2,5-dimethylphenyl)alumane.
Molecular Properties
| Compound Name | tris(2,5-dimethylphenyl)alumane |
| PubChem CID | 173265347 |
| Molecular Formula | C24H27Al |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tris(2,5-dimethylphenyl)alumane |
| SMILES | Cc1ccc(C)c([Al](c2cc(C)ccc2C)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/3C8H9.Al/c3*1-7-3-5-8(2)6-4-7;/h3*3-5H,1-2H3; |
| InChIKey | FUXGJFDAWNONMB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tris(2,5-dimethylphenyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2,5-dimethylphenyl)alumane?
The IUPAC name of tris(2,5-dimethylphenyl)alumane (CID 173265347) is tris(2,5-dimethylphenyl)alumane.
What is the SMILES notation for tris(2,5-dimethylphenyl)alumane?
The canonical SMILES for tris(2,5-dimethylphenyl)alumane is Cc1ccc(C)c([Al](c2cc(C)ccc2C)c2cc(C)ccc2C)c1.
What is the InChIKey of tris(2,5-dimethylphenyl)alumane?
The InChIKey is FUXGJFDAWNONMB-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H9.Al/c3*1-7-3-5-8(2)6-4-7;/h3*3-5H,1-2H3;.
What are the key properties of tris(2,5-dimethylphenyl)alumane?
tris(2,5-dimethylphenyl)alumane has a molecular weight of 342.46 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2,5-dimethylphenyl)alumane is sourced from PubChem (CID 173265347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).