C28H40O6Si2 — CID 173266153
[2,5-dimethyl-2-(4-trimethylsilylbenzoyl)peroxycyclohexyl] 4-trimethylsilylbenzenecarboperoxoate (PubChem CID 173266153) has the molecular formula C28H40O6Si2 and a molecular weight of 528.79 g/mol. Its IUPAC name is [2,5-dimethyl-2-(4-trimethylsilylbenzoyl)peroxycyclohexyl] 4-trimethylsilylbenzenecarboperoxoate.
| Compound Name | [2,5-dimethyl-2-(4-trimethylsilylbenzoyl)peroxycyclohexyl] 4-trimethylsilylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266153 |
| Molecular Formula | C28H40O6Si2 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | [2,5-dimethyl-2-(4-trimethylsilylbenzoyl)peroxycyclohexyl] 4-trimethylsilylbenzenecarboperoxoate |
| SMILES | CC1CCC(C)(OOC(=O)c2ccc([Si](C)(C)C)cc2)C(OOC(=O)c2ccc([Si](C)(C)C)cc2)C1 |
| InChI | InChI=1S/C28H40O6Si2/c1-20-17-18-28(2,34-33-27(30)22-11-15-24(16-12-22)36(6,7)8)25(19-20)31-32-26(29)21-9-13-23(14-10-21)35(3,4)5/h9-16,20,25H,17-19H2,1-8H3 |
| InChIKey | MMKNXCSEHXHBNT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|