About bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium
bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium (PubChem CID 173266465) has the molecular formula C20H30Hf-2
and a molecular weight of 448.95 g/mol. Its IUPAC name is bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium.
Molecular Properties
| Compound Name | bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium |
| PubChem CID | 173266465 |
| Molecular Formula | C20H30Hf-2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium |
| SMILES | CCCCC1=CCC(C)=[C-]1.CCCCC1=CCC(C)=[C-]1.[Hf] |
| InChI | InChI=1S/2C10H15.Hf/c2*1-3-4-5-10-7-6-9(2)8-10;/h2*7H,3-6H2,1-2H3;/q2*-1; |
| InChIKey | VEIBDIDBOVXSJH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium?
The IUPAC name of bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium (CID 173266465) is bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium.
What is the SMILES notation for bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium?
The canonical SMILES for bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium is CCCCC1=CCC(C)=[C-]1.CCCCC1=CCC(C)=[C-]1.[Hf].
What is the InChIKey of bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium?
The InChIKey is VEIBDIDBOVXSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H15.Hf/c2*1-3-4-5-10-7-6-9(2)8-10;/h2*7H,3-6H2,1-2H3;/q2*-1;.
What are the key properties of bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium?
bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium has a molecular weight of 448.95 g/mol, XLogP of 6.51, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-butyl-1-methylcyclopenta-1,3-diene);hafnium is sourced from PubChem (CID 173266465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).