C13H18O4 — CID 173267302
2-ethoxyethyl 2,6-dimethylbenzenecarboperoxoate (PubChem CID 173267302) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-ethoxyethyl 2,6-dimethylbenzenecarboperoxoate.
| Compound Name | 2-ethoxyethyl 2,6-dimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267302 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-ethoxyethyl 2,6-dimethylbenzenecarboperoxoate |
| SMILES | CCOCCOOC(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C13H18O4/c1-4-15-8-9-16-17-13(14)12-10(2)6-5-7-11(12)3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | MFSDIZXKDWGXDF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|