C10H20O6PS2+ — CID 173268073
[3,4-dicarboxyhexan-3-yl(dimethoxy)-λ4-sulfanyl]-sulfanylidenephosphanium (PubChem CID 173268073) has the molecular formula C10H20O6PS2+ and a molecular weight of 331.37 g/mol. Its IUPAC name is [3,4-dicarboxyhexan-3-yl(dimethoxy)-λ4-sulfanyl]-sulfanylidenephosphanium.
| Compound Name | [3,4-dicarboxyhexan-3-yl(dimethoxy)-λ4-sulfanyl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 173268073 |
| Molecular Formula | C10H20O6PS2+ |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [3,4-dicarboxyhexan-3-yl(dimethoxy)-λ4-sulfanyl]-sulfanylidenephosphanium |
| SMILES | CCC(C(=O)O)C(CC)(C(=O)O)S(OC)(OC)[PH+]=S |
| InChI | InChI=1S/C10H19O6PS2/c1-5-7(8(11)12)10(6-2,9(13)14)19(15-3,16-4)17-18/h7H,5-6H2,1-4H3,(H,11,12)(H,13,14)/p+1 |
| InChIKey | KAMHPLSXYQVIQJ-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|