C25H51CrN5 — CID 173268152
chromium(2+);10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine;bis(diethylazanide) (PubChem CID 173268152) has the molecular formula C25H51CrN5 and a molecular weight of 473.71 g/mol. Its IUPAC name is chromium(2+);10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine;bis(diethylazanide).
| Compound Name | chromium(2+);10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine;bis(diethylazanide) |
|---|---|
| PubChem CID | 173268152 |
| Molecular Formula | C25H51CrN5 |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | chromium(2+);10-cyclodec-2-en-1-yl-1,4,5,6,7,8,9,10-octahydro-1,3,7-triazecine;bis(diethylazanide) |
| SMILES | C1=CC(C2CCNCCC/N=C\N2)CCCCCCC1.CC[N-]CC.CC[N-]CC.[Cr+2] |
| InChI | InChI=1S/C17H31N3.2C4H10N.Cr/c1-2-4-6-9-16(10-7-5-3-1)17-11-14-18-12-8-13-19-15-20-17;2*1-3-5-4-2;/h6,9,15-18H,1-5,7-8,10-14H2,(H,19,20);2*3-4H2,1-2H3;/q;2*-1;+2 |
| InChIKey | HVFWHLZHSQCQQI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|