About CID 173268155
CID 173268155 (PubChem CID 173268155) has the molecular formula C20H44Al
and a molecular weight of 311.55 g/mol.
Molecular Properties
| Compound Name | CID 173268155 |
| PubChem CID | 173268155 |
| Molecular Formula | C20H44Al |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.33 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC[Al]CCCCCCCCCC.[H][H] |
| InChI | InChI=1S/2C10H21.Al.H2/c2*1-3-5-7-9-10-8-6-4-2;;/h2*1,3-10H2,2H3;;1H |
| InChIKey | BOXHLTYVRHQYGX-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 173268155 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173268155?
The IUPAC name of CID 173268155 (CID 173268155) is not available.
What is the SMILES notation for CID 173268155?
The canonical SMILES for CID 173268155 is CCCCCCCCCC[Al]CCCCCCCCCC.[H][H].
What is the InChIKey of CID 173268155?
The InChIKey is BOXHLTYVRHQYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H21.Al.H2/c2*1-3-5-7-9-10-8-6-4-2;;/h2*1,3-10H2,2H3;;1H.
What are the key properties of CID 173268155?
CID 173268155 has a molecular weight of 311.55 g/mol, XLogP of 8.05, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173268155 is sourced from PubChem (CID 173268155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).