About 2,4-dinitro-1H-arsole
2,4-dinitro-1H-arsole (PubChem CID 173268745) has the molecular formula C4H3AsN2O4
and a molecular weight of 218.00 g/mol. Its IUPAC name is 2,4-dinitro-1H-arsole.
Molecular Properties
| Compound Name | 2,4-dinitro-1H-arsole |
| PubChem CID | 173268745 |
| Molecular Formula | C4H3AsN2O4 |
| Molecular Weight | 218.00 g/mol |
| Exact Mass | 217.93 |
| IUPAC Name | 2,4-dinitro-1H-arsole |
| SMILES | O=[N+]([O-])C1=C[AsH]C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C4H3AsN2O4/c8-6(9)3-1-4(5-2-3)7(10)11/h1-2,5H |
| InChIKey | AUORLNWOGYMVEX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.00 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitro-1H-arsole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitro-1H-arsole?
The IUPAC name of 2,4-dinitro-1H-arsole (CID 173268745) is 2,4-dinitro-1H-arsole.
What is the SMILES notation for 2,4-dinitro-1H-arsole?
The canonical SMILES for 2,4-dinitro-1H-arsole is O=[N+]([O-])C1=C[AsH]C([N+](=O)[O-])=C1.
What is the InChIKey of 2,4-dinitro-1H-arsole?
The InChIKey is AUORLNWOGYMVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3AsN2O4/c8-6(9)3-1-4(5-2-3)7(10)11/h1-2,5H.
What are the key properties of 2,4-dinitro-1H-arsole?
2,4-dinitro-1H-arsole has a molecular weight of 218.00 g/mol, XLogP of -0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitro-1H-arsole is sourced from PubChem (CID 173268745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).