C31H35BrO5 — CID 173268944
[(3aR,4R,5R,6aS)-4-(2-bromo-5-cyclohexyl-3-hydroxypent-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 173268944) has the molecular formula C31H35BrO5 and a molecular weight of 567.52 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(2-bromo-5-cyclohexyl-3-hydroxypent-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(2-bromo-5-cyclohexyl-3-hydroxypent-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 173268944 |
| Molecular Formula | C31H35BrO5 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(2-bromo-5-cyclohexyl-3-hydroxypent-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | O=C1C[C@@H]2[C@H](C=C(Br)C(O)CCC3CCCCC3)[C@H](OC(=O)c3ccc(-c4ccccc4)cc3)C[C@@H]2O1 |
| InChI | InChI=1S/C31H35BrO5/c32-26(27(33)16-11-20-7-3-1-4-8-20)17-24-25-18-30(34)36-28(25)19-29(24)37-31(35)23-14-12-22(13-15-23)21-9-5-2-6-10-21/h2,5-6,9-10,12-15,17,20,24-25,27-29,33H,1,3-4,7-8,11,16,18-19H2/t24-,25+,27?,28-,29+/m0/s1 |
| InChIKey | WDRRZNGKGQMEJJ-DXZZSZIISA-N |
| XLogP | 6.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |