C19H27BiN4O10S — CID 173269458
bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,1,2-tricarboxylate (PubChem CID 173269458) has the molecular formula C19H27BiN4O10S and a molecular weight of 712.49 g/mol. Its IUPAC name is bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,1,2-tricarboxylate.
| Compound Name | bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 173269458 |
| Molecular Formula | C19H27BiN4O10S |
| Molecular Weight | 712.49 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,1,2-tricarboxylate |
| SMILES | CC(O)(C(=O)[O-])C(C(=O)[O-])C(=O)[O-].CNC(=C[N+](=O)[O-])NCCSCc1ccc(CN(C)C)o1.[Bi+3] |
| InChI | InChI=1S/C13H22N4O3S.C6H8O7.Bi/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3;1-6(13,5(11)12)2(3(7)8)4(9)10;/h4-5,9,14-15H,6-8,10H2,1-3H3;2,13H,1H3,(H,7,8)(H,9,10)(H,11,12);/q;;+3/p-3 |
| InChIKey | JKDACOWDTBMPCJ-UHFFFAOYSA-K |
| XLogP | -4.32 |
| TPSA | 224.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.49 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|