About 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane
4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane (PubChem CID 173269693) has the molecular formula C19H20N4O6S
and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane.
Molecular Properties
| Compound Name | 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane |
| PubChem CID | 173269693 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane |
| SMILES | CC(=C1C(=O)N(c2ccc(S(=O)(=O)O)cc2)N=C1C(=O)O)c1ccc(N)cc1C.N |
| InChI | InChI=1S/C19H17N3O6S.H3N/c1-10-9-12(20)3-8-15(10)11(2)16-17(19(24)25)21-22(18(16)23)13-4-6-14(7-5-13)29(26,27)28;/h3-9H,20H2,1-2H3,(H,24,25)(H,26,27,28);1H3 |
| InChIKey | DEJJYPVDPNENQU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 185.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane?
The IUPAC name of 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane (CID 173269693) is 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane.
What is the SMILES notation for 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane?
The canonical SMILES for 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane is CC(=C1C(=O)N(c2ccc(S(=O)(=O)O)cc2)N=C1C(=O)O)c1ccc(N)cc1C.N.
What is the InChIKey of 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane?
The InChIKey is DEJJYPVDPNENQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O6S.H3N/c1-10-9-12(20)3-8-15(10)11(2)16-17(19(24)25)21-22(18(16)23)13-4-6-14(7-5-13)29(26,27)28;/h3-9H,20H2,1-2H3,(H,24,25)(H,26,27,28);1H3.
What are the key properties of 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane?
4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane has a molecular weight of 432.46 g/mol, XLogP of 2.25, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-amino-2-methylphenyl)ethylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylic acid;azane is sourced from PubChem (CID 173269693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).