C34H34O6 — CID 173269771
2-ethoxy-3-(3-methyl-4-phenylmethoxyphenyl)prop-2-enoic acid;3-methyl-4-phenylmethoxybenzaldehyde (PubChem CID 173269771) has the molecular formula C34H34O6 and a molecular weight of 538.64 g/mol. Its IUPAC name is 2-ethoxy-3-(3-methyl-4-phenylmethoxyphenyl)prop-2-enoic acid;3-methyl-4-phenylmethoxybenzaldehyde.
| Compound Name | 2-ethoxy-3-(3-methyl-4-phenylmethoxyphenyl)prop-2-enoic acid;3-methyl-4-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 173269771 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 2-ethoxy-3-(3-methyl-4-phenylmethoxyphenyl)prop-2-enoic acid;3-methyl-4-phenylmethoxybenzaldehyde |
| SMILES | CCOC(=Cc1ccc(OCc2ccccc2)c(C)c1)C(=O)O.Cc1cc(C=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H20O4.C15H14O2/c1-3-22-18(19(20)21)12-16-9-10-17(14(2)11-16)23-13-15-7-5-4-6-8-15;1-12-9-14(10-16)7-8-15(12)17-11-13-5-3-2-4-6-13/h4-12H,3,13H2,1-2H3,(H,20,21);2-10H,11H2,1H3 |
| InChIKey | CPJZACAFUKYALM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|