C37H64O10Si — CID 173269973
methyl 9-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate (PubChem CID 173269973) has the molecular formula C37H64O10Si and a molecular weight of 696.99 g/mol. Its IUPAC name is methyl 9-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate.
| Compound Name | methyl 9-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate |
|---|---|
| PubChem CID | 173269973 |
| Molecular Formula | C37H64O10Si |
| Molecular Weight | 696.99 g/mol |
| Exact Mass | 696.43 |
| IUPAC Name | methyl 9-[(1R,2S,3R,5S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-2-(oxan-2-yloxy)-3-oxonon-7-enoate |
| SMILES | COC(=O)C(OC1CCCCO1)C(=O)CCCC=CC[C@@H]1[C@H](C(O[SiH](C)C)C(C)(C)C)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C37H64O10Si/c1-37(2,3)35(47-48(5)6)33-26(28(44-30-19-11-14-22-41-30)25-29(33)45-31-20-12-15-23-42-31)17-9-7-8-10-18-27(38)34(36(39)40-4)46-32-21-13-16-24-43-32/h7,9,26,28-35,48H,8,10-25H2,1-6H3/t26-,28-,29+,30?,31?,32?,33-,34?,35?/m0/s1 |
| InChIKey | SWDNARLKWHGANJ-NADFFIPWSA-N |
| XLogP | 6.63 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.99 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|