C14H14Cl2N6OS — CID 173270499
2-[(E)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-7,8-dihydro-6H-cinnolin-5-ylidene]amino]-1-hydroxyguanidine (PubChem CID 173270499) has the molecular formula C14H14Cl2N6OS and a molecular weight of 385.28 g/mol. Its IUPAC name is 2-[(E)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-7,8-dihydro-6H-cinnolin-5-ylidene]amino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-7,8-dihydro-6H-cinnolin-5-ylidene]amino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 173270499 |
| Molecular Formula | C14H14Cl2N6OS |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[(E)-[7-(2,5-dichlorothiophen-3-yl)-4-methyl-7,8-dihydro-6H-cinnolin-5-ylidene]amino]-1-hydroxyguanidine |
| SMILES | Cc1cnnc2c1/C(=N/N=C(N)NO)CC(c1cc(Cl)sc1Cl)C2 |
| InChI | InChI=1S/C14H14Cl2N6OS/c1-6-5-18-19-9-2-7(8-4-11(15)24-13(8)16)3-10(12(6)9)20-21-14(17)22-23/h4-5,7,23H,2-3H2,1H3,(H3,17,21,22)/b20-10+ |
| InChIKey | PLVUQYFAJJBHNF-KEBDBYFISA-N |
| XLogP | 2.88 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|