C30H51NO4Si — CID 173270727
tert-butyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 173270727) has the molecular formula C30H51NO4Si and a molecular weight of 517.83 g/mol. Its IUPAC name is tert-butyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 173270727 |
| Molecular Formula | C30H51NO4Si |
| Molecular Weight | 517.83 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | tert-butyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CCCC(C[C@@H]1[C@H](C(O[SiH](C)C)C(C)(C)C)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C30H51NO4Si/c1-11-15-23(21(2)32)18-25-24(27(29(3,4)5)35-36(9)10)19-26(28(33)34-30(6,7)8)31(25)20-22-16-13-12-14-17-22/h12-14,16-17,23-27,36H,11,15,18-20H2,1-10H3/t23?,24-,25-,26-,27?/m1/s1 |
| InChIKey | UNGZIELTRTVSFG-FTBNBGDLSA-N |
| XLogP | 6.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.83 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|