C20H28 — CID 173270860
2,3,4,4,5,6,8,8-octamethyl-1,7-dihydro-s-indacene (PubChem CID 173270860) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,3,4,4,5,6,8,8-octamethyl-1,7-dihydro-s-indacene.
| Compound Name | 2,3,4,4,5,6,8,8-octamethyl-1,7-dihydro-s-indacene |
|---|---|
| PubChem CID | 173270860 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2,3,4,4,5,6,8,8-octamethyl-1,7-dihydro-s-indacene |
| SMILES | CC1=C(C)C2=C(C1)C(C)(C)C1=C(C(C)=C(C)C1)C2(C)C |
| InChI | InChI=1S/C20H28/c1-11-9-15-17(13(11)3)20(7,8)18-14(4)12(2)10-16(18)19(15,5)6/h9-10H2,1-8H3 |
| InChIKey | PTCVDGVKZCKMSR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |