C8H11NaO9 — CID 173271021
sodium;acetic acid;3-carboxy-3,5-dihydroxy-5-oxopentanoate (PubChem CID 173271021) has the molecular formula C8H11NaO9 and a molecular weight of 274.16 g/mol. Its IUPAC name is sodium;acetic acid;3-carboxy-3,5-dihydroxy-5-oxopentanoate.
| Compound Name | sodium;acetic acid;3-carboxy-3,5-dihydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 173271021 |
| Molecular Formula | C8H11NaO9 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | sodium;acetic acid;3-carboxy-3,5-dihydroxy-5-oxopentanoate |
| SMILES | CC(=O)O.O=C([O-])CC(O)(CC(=O)O)C(=O)O.[Na+] |
| InChI | InChI=1S/C6H8O7.C2H4O2.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2(3)4;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | WXKPPMQZRGORPB-UHFFFAOYSA-M |
| XLogP | -5.49 |
| TPSA | 172.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |