About 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene
1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene (PubChem CID 173271206) has the molecular formula C14H6Cl2F6
and a molecular weight of 359.10 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene |
| PubChem CID | 173271206 |
| Molecular Formula | C14H6Cl2F6 |
| Molecular Weight | 359.10 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(-c2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H6Cl2F6/c15-11-4-1-7(5-12(11)16)9-3-2-8(13(17,18)19)6-10(9)14(20,21)22/h1-6H |
| InChIKey | URARRHIMDCQGOF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.10 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene?
The IUPAC name of 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene (CID 173271206) is 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene is FC(F)(F)c1ccc(-c2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene?
The InChIKey is URARRHIMDCQGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl2F6/c15-11-4-1-7(5-12(11)16)9-3-2-8(13(17,18)19)6-10(9)14(20,21)22/h1-6H.
What are the key properties of 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene?
1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene has a molecular weight of 359.10 g/mol, XLogP of 6.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-2,4-bis(trifluoromethyl)benzene is sourced from PubChem (CID 173271206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).