C9H22ClNO3S — CID 173271684
[(2R,3S)-2-amino-3,4,4-trimethylpentyl] methanesulfonate;hydrochloride (PubChem CID 173271684) has the molecular formula C9H22ClNO3S and a molecular weight of 259.80 g/mol. Its IUPAC name is [(2R,3S)-2-amino-3,4,4-trimethylpentyl] methanesulfonate;hydrochloride.
| Compound Name | [(2R,3S)-2-amino-3,4,4-trimethylpentyl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 173271684 |
| Molecular Formula | C9H22ClNO3S |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [(2R,3S)-2-amino-3,4,4-trimethylpentyl] methanesulfonate;hydrochloride |
| SMILES | C[C@H]([C@@H](N)COS(C)(=O)=O)C(C)(C)C.Cl |
| InChI | InChI=1S/C9H21NO3S.ClH/c1-7(9(2,3)4)8(10)6-13-14(5,11)12;/h7-8H,6,10H2,1-5H3;1H/t7-,8+;/m1./s1 |
| InChIKey | WXYYEFOOPCQFOE-WLYNEOFISA-N |
| XLogP | 1.39 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|