About 2-hydroxyethyl N-propylidenecarbamate
2-hydroxyethyl N-propylidenecarbamate (PubChem CID 173271685) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-hydroxyethyl N-propylidenecarbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-propylidenecarbamate |
| PubChem CID | 173271685 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-hydroxyethyl N-propylidenecarbamate |
| SMILES | CCC=NC(=O)OCCO |
| InChI | InChI=1S/C6H11NO3/c1-2-3-7-6(9)10-5-4-8/h3,8H,2,4-5H2,1H3 |
| InChIKey | LFDOTMXBRVCQFM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl N-propylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-propylidenecarbamate?
The IUPAC name of 2-hydroxyethyl N-propylidenecarbamate (CID 173271685) is 2-hydroxyethyl N-propylidenecarbamate.
What is the SMILES notation for 2-hydroxyethyl N-propylidenecarbamate?
The canonical SMILES for 2-hydroxyethyl N-propylidenecarbamate is CCC=NC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-propylidenecarbamate?
The InChIKey is LFDOTMXBRVCQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-2-3-7-6(9)10-5-4-8/h3,8H,2,4-5H2,1H3.
What are the key properties of 2-hydroxyethyl N-propylidenecarbamate?
2-hydroxyethyl N-propylidenecarbamate has a molecular weight of 145.16 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-propylidenecarbamate is sourced from PubChem (CID 173271685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).