About dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride
dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride (PubChem CID 173272303) has the molecular formula C6H13K2NO4S
and a molecular weight of 273.44 g/mol. Its IUPAC name is dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride.
Molecular Properties
| Compound Name | dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride |
| PubChem CID | 173272303 |
| Molecular Formula | C6H13K2NO4S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride |
| SMILES | O=C(O)CNCCSCC(=O)O.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C6H11NO4S.2K.2H/c8-5(9)3-7-1-2-12-4-6(10)11;;;;/h7H,1-4H2,(H,8,9)(H,10,11);;;;/q;2*+1;2*-1 |
| InChIKey | TWUDHGDWXAOLHF-UHFFFAOYSA-N |
| XLogP | -6.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride?
The IUPAC name of dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride (CID 173272303) is dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride.
What is the SMILES notation for dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride?
The canonical SMILES for dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride is O=C(O)CNCCSCC(=O)O.[H-].[H-].[K+].[K+].
What is the InChIKey of dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride?
The InChIKey is TWUDHGDWXAOLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4S.2K.2H/c8-5(9)3-7-1-2-12-4-6(10)11;;;;/h7H,1-4H2,(H,8,9)(H,10,11);;;;/q;2*+1;2*-1.
What are the key properties of dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride?
dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride has a molecular weight of 273.44 g/mol, XLogP of -6.29, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-[2-(carboxymethylsulfanyl)ethylamino]acetic acid;hydride is sourced from PubChem (CID 173272303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).