C18H38O2Si — CID 173272607
1-[2-(2,2,4,4-tetramethylpentan-3-ylsilyloxy)cyclohexyl]propan-2-ol (PubChem CID 173272607) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is 1-[2-(2,2,4,4-tetramethylpentan-3-ylsilyloxy)cyclohexyl]propan-2-ol.
| Compound Name | 1-[2-(2,2,4,4-tetramethylpentan-3-ylsilyloxy)cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 173272607 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1-[2-(2,2,4,4-tetramethylpentan-3-ylsilyloxy)cyclohexyl]propan-2-ol |
| SMILES | CC(O)CC1CCCCC1O[SiH2]C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-13(19)12-14-10-8-9-11-15(14)20-21-16(17(2,3)4)18(5,6)7/h13-16,19H,8-12,21H2,1-7H3 |
| InChIKey | SDIKGKZNCLNIAC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|