C29H36SiZr — CID 173272690
cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide;siletan-1-ylidenezirconium(2+) (PubChem CID 173272690) has the molecular formula C29H36SiZr and a molecular weight of 503.92 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide;siletan-1-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide;siletan-1-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173272690 |
| Molecular Formula | C29H36SiZr |
| Molecular Weight | 503.92 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide;siletan-1-ylidenezirconium(2+) |
| SMILES | CC(C)(C)c1ccc2[cH-]c3ccc(C(C)(C)C)cc3c2c1.[C-]1=CC=CC1.[Zr+2]=[Si]1CCC1 |
| InChI | InChI=1S/C21H25.C5H5.C3H6Si.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-2-4-5-3-1;1-2-4-3-1;/h7-13H,1-6H3;1-3H,4H2;1-3H2;/q2*-1;;+2 |
| InChIKey | SGBMJXVUTVIDRM-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.92 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|