C8H4N2S2 — CID 173272937
5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene (PubChem CID 173272937) has the molecular formula C8H4N2S2 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene.
| Compound Name | 5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
|---|---|
| PubChem CID | 173272937 |
| Molecular Formula | C8H4N2S2 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
| SMILES | c1ncc2c(n1)sc1sccc12 |
| InChI | InChI=1S/C8H4N2S2/c1-2-11-8-5(1)6-3-9-4-10-7(6)12-8/h1-4H |
| InChIKey | KQKFNEOHQJEUHZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |