About (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane
(3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane (PubChem CID 173272946) has the molecular formula C14H30OSi
and a molecular weight of 242.48 g/mol. Its IUPAC name is (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane.
Molecular Properties
| Compound Name | (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane |
| PubChem CID | 173272946 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane |
| SMILES | CC(C)(C)C1CCCCC(CO[SiH3])C1(C)C |
| InChI | InChI=1S/C14H30OSi/c1-13(2,3)12-9-7-6-8-11(10-15-16)14(12,4)5/h11-12H,6-10H2,1-5,16H3 |
| InChIKey | IQOKSUNMAMXUCI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane?
The IUPAC name of (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane (CID 173272946) is (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane.
What is the SMILES notation for (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane?
The canonical SMILES for (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane is CC(C)(C)C1CCCCC(CO[SiH3])C1(C)C.
What is the InChIKey of (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane?
The InChIKey is IQOKSUNMAMXUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30OSi/c1-13(2,3)12-9-7-6-8-11(10-15-16)14(12,4)5/h11-12H,6-10H2,1-5,16H3.
What are the key properties of (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane?
(3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane has a molecular weight of 242.48 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-2,2-dimethylcycloheptyl)methoxysilane is sourced from PubChem (CID 173272946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).