About 2-cyclopentylthiolane
2-cyclopentylthiolane (PubChem CID 173273032) has the molecular formula C9H16S
and a molecular weight of 156.29 g/mol. Its IUPAC name is 2-cyclopentylthiolane.
Molecular Properties
| Compound Name | 2-cyclopentylthiolane |
| PubChem CID | 173273032 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-cyclopentylthiolane |
| SMILES | C1CCC(C2CCCS2)C1 |
| InChI | InChI=1S/C9H16S/c1-2-5-8(4-1)9-6-3-7-10-9/h8-9H,1-7H2 |
| InChIKey | YPAVUIWXFWWACP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopentylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylthiolane?
The IUPAC name of 2-cyclopentylthiolane (CID 173273032) is 2-cyclopentylthiolane.
What is the SMILES notation for 2-cyclopentylthiolane?
The canonical SMILES for 2-cyclopentylthiolane is C1CCC(C2CCCS2)C1.
What is the InChIKey of 2-cyclopentylthiolane?
The InChIKey is YPAVUIWXFWWACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16S/c1-2-5-8(4-1)9-6-3-7-10-9/h8-9H,1-7H2.
What are the key properties of 2-cyclopentylthiolane?
2-cyclopentylthiolane has a molecular weight of 156.29 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylthiolane is sourced from PubChem (CID 173273032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).