C12H14N2O4S — CID 173273801
(E)-N'-methylsulfonyl-N-(2-oxoethyl)-3-phenylprop-2-enehydrazide (PubChem CID 173273801) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is (E)-N'-methylsulfonyl-N-(2-oxoethyl)-3-phenylprop-2-enehydrazide.
| Compound Name | (E)-N'-methylsulfonyl-N-(2-oxoethyl)-3-phenylprop-2-enehydrazide |
|---|---|
| PubChem CID | 173273801 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-N'-methylsulfonyl-N-(2-oxoethyl)-3-phenylprop-2-enehydrazide |
| SMILES | CS(=O)(=O)NN(CC=O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-19(17,18)13-14(9-10-15)12(16)8-7-11-5-3-2-4-6-11/h2-8,10,13H,9H2,1H3/b8-7+ |
| InChIKey | WITXOCBONXXVHH-BQYQJAHWSA-N |
| XLogP | 0.19 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|