About silane;2-(thiepan-2-ylmethyl)thiepane
silane;2-(thiepan-2-ylmethyl)thiepane (PubChem CID 173274249) has the molecular formula C13H28S2Si
and a molecular weight of 276.59 g/mol. Its IUPAC name is silane;2-(thiepan-2-ylmethyl)thiepane.
Molecular Properties
| Compound Name | silane;2-(thiepan-2-ylmethyl)thiepane |
| PubChem CID | 173274249 |
| Molecular Formula | C13H28S2Si |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | silane;2-(thiepan-2-ylmethyl)thiepane |
| SMILES | C1CCSC(CC2CCCCCS2)CC1.[SiH4] |
| InChI | InChI=1S/C13H24S2.H4Si/c1-3-7-12(14-9-5-1)11-13-8-4-2-6-10-15-13;/h12-13H,1-11H2;1H4 |
| InChIKey | GRZRMHDHGHELHN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silane;2-(thiepan-2-ylmethyl)thiepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;2-(thiepan-2-ylmethyl)thiepane?
The IUPAC name of silane;2-(thiepan-2-ylmethyl)thiepane (CID 173274249) is silane;2-(thiepan-2-ylmethyl)thiepane.
What is the SMILES notation for silane;2-(thiepan-2-ylmethyl)thiepane?
The canonical SMILES for silane;2-(thiepan-2-ylmethyl)thiepane is C1CCSC(CC2CCCCCS2)CC1.[SiH4].
What is the InChIKey of silane;2-(thiepan-2-ylmethyl)thiepane?
The InChIKey is GRZRMHDHGHELHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24S2.H4Si/c1-3-7-12(14-9-5-1)11-13-8-4-2-6-10-15-13;/h12-13H,1-11H2;1H4.
What are the key properties of silane;2-(thiepan-2-ylmethyl)thiepane?
silane;2-(thiepan-2-ylmethyl)thiepane has a molecular weight of 276.59 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silane;2-(thiepan-2-ylmethyl)thiepane is sourced from PubChem (CID 173274249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).