C21H30O4 — CID 173274487
methyl (1R,2E,4R,5R,9R,12S)-1-hydroxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate (PubChem CID 173274487) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (1R,2E,4R,5R,9R,12S)-1-hydroxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate.
| Compound Name | methyl (1R,2E,4R,5R,9R,12S)-1-hydroxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate |
|---|---|
| PubChem CID | 173274487 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (1R,2E,4R,5R,9R,12S)-1-hydroxy-8,12-dimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate |
| SMILES | COC(=O)/C1=C/[C@H]2[C@@H](C(C)C)CC=C(C)[C@@H]2CC[C@@]2(C)C=C[C@@]1(O)O2 |
| InChI | InChI=1S/C21H30O4/c1-13(2)15-7-6-14(3)16-8-9-20(4)10-11-21(23,25-20)18(12-17(15)16)19(22)24-5/h6,10-13,15-17,23H,7-9H2,1-5H3/b18-12-/t15-,16+,17+,20+,21-/m1/s1 |
| InChIKey | DBIDGMTVASJPLX-IKCNSWSFSA-N |
| XLogP | 3.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|