About 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene
4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene (PubChem CID 173274745) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene.
Molecular Properties
| Compound Name | 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene |
| PubChem CID | 173274745 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene |
| SMILES | CC(C)CC=C(CC(C)C)OC(=CCC(C)C)CC(C)C |
| InChI | InChI=1S/C20H38O/c1-15(2)9-11-19(13-17(5)6)21-20(14-18(7)8)12-10-16(3)4/h11-12,15-18H,9-10,13-14H2,1-8H3 |
| InChIKey | KMISGILDWVHZQU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene?
The IUPAC name of 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene (CID 173274745) is 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene.
What is the SMILES notation for 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene?
The canonical SMILES for 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene is CC(C)CC=C(CC(C)C)OC(=CCC(C)C)CC(C)C.
What is the InChIKey of 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene?
The InChIKey is KMISGILDWVHZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O/c1-15(2)9-11-19(13-17(5)6)21-20(14-18(7)8)12-10-16(3)4/h11-12,15-18H,9-10,13-14H2,1-8H3.
What are the key properties of 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene?
4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene has a molecular weight of 294.52 g/mol, XLogP of 6.96, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-dimethyloct-4-en-4-yloxy)-2,7-dimethyloct-4-ene is sourced from PubChem (CID 173274745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).