C44H76O12 — CID 173274924
2,3-dioctylbut-2-enedioic acid;bis(2-(2-ethylhexyl)but-2-enedioic acid) (PubChem CID 173274924) has the molecular formula C44H76O12 and a molecular weight of 797.08 g/mol. Its IUPAC name is 2,3-dioctylbut-2-enedioic acid;bis(2-(2-ethylhexyl)but-2-enedioic acid).
| Compound Name | 2,3-dioctylbut-2-enedioic acid;bis(2-(2-ethylhexyl)but-2-enedioic acid) |
|---|---|
| PubChem CID | 173274924 |
| Molecular Formula | C44H76O12 |
| Molecular Weight | 797.08 g/mol |
| Exact Mass | 796.53 |
| IUPAC Name | 2,3-dioctylbut-2-enedioic acid;bis(2-(2-ethylhexyl)but-2-enedioic acid) |
| SMILES | CCCCC(CC)CC(=CC(=O)O)C(=O)O.CCCCC(CC)CC(=CC(=O)O)C(=O)O.CCCCCCCCC(C(=O)O)=C(CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C20H36O4.2C12H20O4/c1-3-5-7-9-11-13-15-17(19(21)22)18(20(23)24)16-14-12-10-8-6-4-2;2*1-3-5-6-9(4-2)7-10(12(15)16)8-11(13)14/h3-16H2,1-2H3,(H,21,22)(H,23,24);2*8-9H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | FWTPOXFNNJCVKQ-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.08 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|