About 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide
2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide (PubChem CID 173275218) has the molecular formula C4H10N4OS
and a molecular weight of 162.22 g/mol. Its IUPAC name is 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide |
| PubChem CID | 173275218 |
| Molecular Formula | C4H10N4OS |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide |
| SMILES | NC(=O)CC1NCSN1N |
| InChI | InChI=1S/C4H10N4OS/c5-3(9)1-4-7-2-10-8(4)6/h4,7H,1-2,6H2,(H2,5,9) |
| InChIKey | JBXBWNWRQDACGL-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide?
The IUPAC name of 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide (CID 173275218) is 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide.
What is the SMILES notation for 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide?
The canonical SMILES for 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide is NC(=O)CC1NCSN1N.
What is the InChIKey of 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide?
The InChIKey is JBXBWNWRQDACGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4OS/c5-3(9)1-4-7-2-10-8(4)6/h4,7H,1-2,6H2,(H2,5,9).
What are the key properties of 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide?
2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide has a molecular weight of 162.22 g/mol, XLogP of -1.43, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,2,4-thiadiazolidin-3-yl)acetamide is sourced from PubChem (CID 173275218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).