About 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol
2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol (PubChem CID 173275623) has the molecular formula C20H29NO4
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol.
Molecular Properties
| Compound Name | 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol |
| PubChem CID | 173275623 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol |
| SMILES | CC1CCC=CC1(C)C(=Cc1ccccc1)N(OCCO)OCCO |
| InChI | InChI=1S/C20H29NO4/c1-17-8-6-7-11-20(17,2)19(16-18-9-4-3-5-10-18)21(24-14-12-22)25-15-13-23/h3-5,7,9-11,16-17,22-23H,6,8,12-15H2,1-2H3 |
| InChIKey | HELMHCVNLLWYJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol?
The IUPAC name of 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol (CID 173275623) is 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol.
What is the SMILES notation for 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol?
The canonical SMILES for 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol is CC1CCC=CC1(C)C(=Cc1ccccc1)N(OCCO)OCCO.
What is the InChIKey of 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol?
The InChIKey is HELMHCVNLLWYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO4/c1-17-8-6-7-11-20(17,2)19(16-18-9-4-3-5-10-18)21(24-14-12-22)25-15-13-23/h3-5,7,9-11,16-17,22-23H,6,8,12-15H2,1-2H3.
What are the key properties of 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol?
2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol has a molecular weight of 347.46 g/mol, XLogP of 3.17, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(1,6-dimethylcyclohex-2-en-1-yl)-2-phenylethenyl]-(2-hydroxyethoxy)amino]oxyethanol is sourced from PubChem (CID 173275623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).