About 2,5-dimethoxymorpholine
2,5-dimethoxymorpholine (PubChem CID 173275662) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 2,5-dimethoxymorpholine.
Molecular Properties
| Compound Name | 2,5-dimethoxymorpholine |
| PubChem CID | 173275662 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2,5-dimethoxymorpholine |
| SMILES | COC1COC(OC)CN1 |
| InChI | InChI=1S/C6H13NO3/c1-8-5-4-10-6(9-2)3-7-5/h5-7H,3-4H2,1-2H3 |
| InChIKey | DMYMAUMPWBICQU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethoxymorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxymorpholine?
The IUPAC name of 2,5-dimethoxymorpholine (CID 173275662) is 2,5-dimethoxymorpholine.
What is the SMILES notation for 2,5-dimethoxymorpholine?
The canonical SMILES for 2,5-dimethoxymorpholine is COC1COC(OC)CN1.
What is the InChIKey of 2,5-dimethoxymorpholine?
The InChIKey is DMYMAUMPWBICQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-8-5-4-10-6(9-2)3-7-5/h5-7H,3-4H2,1-2H3.
What are the key properties of 2,5-dimethoxymorpholine?
2,5-dimethoxymorpholine has a molecular weight of 147.17 g/mol, XLogP of -0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxymorpholine is sourced from PubChem (CID 173275662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).