About chlorosilane;methane;2-methylpropane
chlorosilane;methane;2-methylpropane (PubChem CID 173275774) has the molecular formula C5H17ClSi
and a molecular weight of 140.73 g/mol. Its IUPAC name is chlorosilane;methane;2-methylpropane.
Molecular Properties
| Compound Name | chlorosilane;methane;2-methylpropane |
| PubChem CID | 173275774 |
| Molecular Formula | C5H17ClSi |
| Molecular Weight | 140.73 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | chlorosilane;methane;2-methylpropane |
| SMILES | C.CC(C)C.[SiH3]Cl |
| InChI | InChI=1S/C4H10.CH4.ClH3Si/c1-4(2)3;;1-2/h4H,1-3H3;1H4;2H3 |
| InChIKey | MOFZHQGQUZREGT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;methane;2-methylpropane?
The IUPAC name of chlorosilane;methane;2-methylpropane (CID 173275774) is chlorosilane;methane;2-methylpropane.
What is the SMILES notation for chlorosilane;methane;2-methylpropane?
The canonical SMILES for chlorosilane;methane;2-methylpropane is C.CC(C)C.[SiH3]Cl.
What is the InChIKey of chlorosilane;methane;2-methylpropane?
The InChIKey is MOFZHQGQUZREGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.CH4.ClH3Si/c1-4(2)3;;1-2/h4H,1-3H3;1H4;2H3.
What are the key properties of chlorosilane;methane;2-methylpropane?
chlorosilane;methane;2-methylpropane has a molecular weight of 140.73 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;methane;2-methylpropane is sourced from PubChem (CID 173275774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).