C22H30Zr — CID 173275794
bis(5,6,7,8,9,9a-hexahydro-4H-cyclopenta[8]annulen-4-ide);zirconium(2+) (PubChem CID 173275794) has the molecular formula C22H30Zr and a molecular weight of 385.71 g/mol. Its IUPAC name is bis(5,6,7,8,9,9a-hexahydro-4H-cyclopenta[8]annulen-4-ide);zirconium(2+).
| Compound Name | bis(5,6,7,8,9,9a-hexahydro-4H-cyclopenta[8]annulen-4-ide);zirconium(2+) |
|---|---|
| PubChem CID | 173275794 |
| Molecular Formula | C22H30Zr |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | bis(5,6,7,8,9,9a-hexahydro-4H-cyclopenta[8]annulen-4-ide);zirconium(2+) |
| SMILES | C1=CC2CCCCC[CH-]C2=C1.C1=CC2CCCCC[CH-]C2=C1.[Zr+2] |
| InChI | InChI=1S/2C11H15.Zr/c2*1-2-4-7-11-9-5-8-10(11)6-3-1;/h2*5-6,8-9,11H,1-4,7H2;/q2*-1;+2 |
| InChIKey | DSDZPONWIVWBPH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|