C25H32BrNO9 — CID 173276722
3-[N-(2-bromoethoxy)-C-methylcarbonimidoyl]-7-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxy-6-methyloxan-2-yl]-8-methyl-4-prop-2-enoxychromen-2-one (PubChem CID 173276722) has the molecular formula C25H32BrNO9 and a molecular weight of 570.43 g/mol. Its IUPAC name is 3-[N-(2-bromoethoxy)-C-methylcarbonimidoyl]-7-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxy-6-methyloxan-2-yl]-8-methyl-4-prop-2-enoxychromen-2-one.
| Compound Name | 3-[N-(2-bromoethoxy)-C-methylcarbonimidoyl]-7-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxy-6-methyloxan-2-yl]-8-methyl-4-prop-2-enoxychromen-2-one |
|---|---|
| PubChem CID | 173276722 |
| Molecular Formula | C25H32BrNO9 |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 3-[N-(2-bromoethoxy)-C-methylcarbonimidoyl]-7-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxy-6-methyloxan-2-yl]-8-methyl-4-prop-2-enoxychromen-2-one |
| SMILES | C=CCOc1c(C(C)=NOCCBr)c(=O)oc2c(C)c([C@@H]3O[C@](C)(CO)[C@H](OC)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C25H32BrNO9/c1-6-10-33-21-16-8-7-15(22-18(29)19(30)23(32-5)25(4,12-28)36-22)13(2)20(16)35-24(31)17(21)14(3)27-34-11-9-26/h6-8,18-19,22-23,28-30H,1,9-12H2,2-5H3/t18-,19-,22+,23-,25-/m1/s1 |
| InChIKey | GACURQMDGDGLCV-RAPMJQEXSA-N |
| XLogP | 2.36 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|