C24H26Zr-2 — CID 173276833
cyclopenta-1,3-diene;di(propan-2-ylidene)zirconium;9H-fluoren-9-ide (PubChem CID 173276833) has the molecular formula C24H26Zr-2 and a molecular weight of 405.70 g/mol. Its IUPAC name is cyclopenta-1,3-diene;di(propan-2-ylidene)zirconium;9H-fluoren-9-ide.
| Compound Name | cyclopenta-1,3-diene;di(propan-2-ylidene)zirconium;9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173276833 |
| Molecular Formula | C24H26Zr-2 |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | cyclopenta-1,3-diene;di(propan-2-ylidene)zirconium;9H-fluoren-9-ide |
| SMILES | CC(C)=[Zr]=C(C)C.[C-]1=CC=CC1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C5H5.2C3H6.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;2*1-3-2;/h1-9H;1-3H,4H2;2*1-2H3;/q2*-1;;; |
| InChIKey | UPOWADBYVNDRTE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|