About 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one
4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one (PubChem CID 173277461) has the molecular formula C10H7F3N2O
and a molecular weight of 228.17 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one |
| PubChem CID | 173277461 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one |
| SMILES | O=C1NC(C(F)(F)F)=Cc2ccccc2N1 |
| InChI | InChI=1S/C10H7F3N2O/c11-10(12,13)8-5-6-3-1-2-4-7(6)14-9(16)15-8/h1-5H,(H2,14,15,16) |
| InChIKey | RVERVKLNXFKUCW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one?
The IUPAC name of 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one (CID 173277461) is 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one.
What is the SMILES notation for 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one?
The canonical SMILES for 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one is O=C1NC(C(F)(F)F)=Cc2ccccc2N1.
What is the InChIKey of 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one?
The InChIKey is RVERVKLNXFKUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O/c11-10(12,13)8-5-6-3-1-2-4-7(6)14-9(16)15-8/h1-5H,(H2,14,15,16).
What are the key properties of 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one?
4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one has a molecular weight of 228.17 g/mol, XLogP of 2.72, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-1,3-dihydro-1,3-benzodiazepin-2-one is sourced from PubChem (CID 173277461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).